C11H12O3 — CID 83877982
1-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanone (PubChem CID 83877982) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanone.
| Compound Name | 1-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanone |
|---|---|
| PubChem CID | 83877982 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-(6-methyl-4H-1,3-benzodioxin-8-yl)ethanone |
| SMILES | CC(=O)c1cc(C)cc2c1OCOC2 |
| InChI | InChI=1S/C11H12O3/c1-7-3-9-5-13-6-14-11(9)10(4-7)8(2)12/h3-4H,5-6H2,1-2H3 |
| InChIKey | ZKBURHLGGGTIAJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |