C10H9FO3 — CID 84666658
1-[6-(fluoromethyl)-1,3-benzodioxol-4-yl]ethanone (PubChem CID 84666658) has the molecular formula C10H9FO3 and a molecular weight of 196.18 g/mol. Its IUPAC name is 1-[6-(fluoromethyl)-1,3-benzodioxol-4-yl]ethanone.
| Compound Name | 1-[6-(fluoromethyl)-1,3-benzodioxol-4-yl]ethanone |
|---|---|
| PubChem CID | 84666658 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-[6-(fluoromethyl)-1,3-benzodioxol-4-yl]ethanone |
| SMILES | CC(=O)c1cc(CF)cc2c1OCO2 |
| InChI | InChI=1S/C10H9FO3/c1-6(12)8-2-7(4-11)3-9-10(8)14-5-13-9/h2-3H,4-5H2,1H3 |
| InChIKey | BKEAQRRGOQNGHC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |