C10H15N3O2 — CID 83884406
N'-hydroxy-2-(2-propan-2-yloxy-4-pyridinyl)ethanimidamide (PubChem CID 83884406) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-hydroxy-2-(2-propan-2-yloxy-4-pyridinyl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2-propan-2-yloxy-4-pyridinyl)ethanimidamide |
|---|---|
| PubChem CID | 83884406 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N'-hydroxy-2-(2-propan-2-yloxy-4-pyridinyl)ethanimidamide |
| SMILES | CC(C)Oc1cc(C/C(N)=N/O)ccn1 |
| InChI | InChI=1S/C10H15N3O2/c1-7(2)15-10-6-8(3-4-12-10)5-9(11)13-14/h3-4,6-7,14H,5H2,1-2H3,(H2,11,13) |
| InChIKey | AOWNKVXOHQRIIF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|