C8H7ClN4O — CID 83885242
8-chloro-N'-hydroxyimidazo[1,2-a]pyridine-2-carboximidamide (PubChem CID 83885242) has the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. Its IUPAC name is 8-chloro-N'-hydroxyimidazo[1,2-a]pyridine-2-carboximidamide.
| Compound Name | 8-chloro-N'-hydroxyimidazo[1,2-a]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 83885242 |
| Molecular Formula | C8H7ClN4O |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 8-chloro-N'-hydroxyimidazo[1,2-a]pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cn2cccc(Cl)c2n1 |
| InChI | InChI=1S/C8H7ClN4O/c9-5-2-1-3-13-4-6(7(10)12-14)11-8(5)13/h1-4,14H,(H2,10,12) |
| InChIKey | QCKSFVKLQNDDGI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|