C7H5ClN4O2 — CID 83885850
7-chloro-1-nitroimidazo[1,5-a]pyridin-3-amine (PubChem CID 83885850) has the molecular formula C7H5ClN4O2 and a molecular weight of 212.60 g/mol. Its IUPAC name is 7-chloro-1-nitroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | 7-chloro-1-nitroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 83885850 |
| Molecular Formula | C7H5ClN4O2 |
| Molecular Weight | 212.60 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 7-chloro-1-nitroimidazo[1,5-a]pyridin-3-amine |
| SMILES | Nc1nc([N+](=O)[O-])c2cc(Cl)ccn12 |
| InChI | InChI=1S/C7H5ClN4O2/c8-4-1-2-11-5(3-4)6(12(13)14)10-7(11)9/h1-3H,(H2,9,10) |
| InChIKey | LCNDBTWWCNAZDG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|