About 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid
3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid (PubChem CID 83892644) has the molecular formula C9H7ClN2O3
and a molecular weight of 226.62 g/mol. Its IUPAC name is 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid.
Analyze 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid?
The IUPAC name of 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid (CID 83892644) is 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid.
What is the SMILES notation for 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid?
The canonical SMILES for 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid is O=C(O)CCc1nc2ncc(Cl)cc2o1.
What is the InChIKey of 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid?
The InChIKey is XANKHBIRJCAULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O3/c10-5-3-6-9(11-4-5)12-7(15-6)1-2-8(13)14/h3-4H,1-2H2,(H,13,14).
What are the key properties of 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid?
3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid has a molecular weight of 226.62 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-[1,3]oxazolo[4,5-b]pyridin-2-yl)propanoic acid is sourced from PubChem (CID 83892644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).