C6H3BrN4O2 — CID 83899513
6-bromo-2-nitro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 83899513) has the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. Its IUPAC name is 6-bromo-2-nitro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-bromo-2-nitro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83899513 |
| Molecular Formula | C6H3BrN4O2 |
| Molecular Weight | 243.02 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 6-bromo-2-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])c1nc2ccc(Br)cn2n1 |
| InChI | InChI=1S/C6H3BrN4O2/c7-4-1-2-5-8-6(11(12)13)9-10(5)3-4/h1-3H |
| InChIKey | PJJDIPDAFZKAFO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.02 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|