About 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid
4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid (PubChem CID 83907789) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid.
Analyze 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The IUPAC name of 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid (CID 83907789) is 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid.
What is the SMILES notation for 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The canonical SMILES for 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid is Cn1cc2c(n1)CCCC2(N)C(=O)O.
What is the InChIKey of 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The InChIKey is YPUSBZOELBLWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-12-5-6-7(11-12)3-2-4-9(6,10)8(13)14/h5H,2-4,10H2,1H3,(H,13,14).
What are the key properties of 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of -0.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-methyl-6,7-dihydro-5H-indazole-4-carboxylic acid is sourced from PubChem (CID 83907789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).