About 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol
4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol (PubChem CID 83909217) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol |
| PubChem CID | 83909217 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol |
| SMILES | NCC1(O)CCCc2onc(C3CC3)c21 |
| InChI | InChI=1S/C11H16N2O2/c12-6-11(14)5-1-2-8-9(11)10(13-15-8)7-3-4-7/h7,14H,1-6,12H2 |
| InChIKey | HXIZIGVUKJEFLP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol?
The IUPAC name of 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol (CID 83909217) is 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol.
What is the SMILES notation for 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol?
The canonical SMILES for 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol is NCC1(O)CCCc2onc(C3CC3)c21.
What is the InChIKey of 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol?
The InChIKey is HXIZIGVUKJEFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c12-6-11(14)5-1-2-8-9(11)10(13-15-8)7-3-4-7/h7,14H,1-6,12H2.
What are the key properties of 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol?
4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol has a molecular weight of 208.26 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3-cyclopropyl-6,7-dihydro-5H-1,2-benzoxazol-4-ol is sourced from PubChem (CID 83909217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).