C10H12ClNO2 — CID 83909881
4-chloro-5-cyclohexyl-1,2-oxazole-3-carbaldehyde (PubChem CID 83909881) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 4-chloro-5-cyclohexyl-1,2-oxazole-3-carbaldehyde.
| Compound Name | 4-chloro-5-cyclohexyl-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 83909881 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-chloro-5-cyclohexyl-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1noc(C2CCCCC2)c1Cl |
| InChI | InChI=1S/C10H12ClNO2/c11-9-8(6-13)12-14-10(9)7-4-2-1-3-5-7/h6-7H,1-5H2 |
| InChIKey | HGHVWYPEPOLWOG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|