C11H9N3O — CID 83915991
3-cyclopropyl-5-isocyanatoimidazo[1,5-a]pyridine (PubChem CID 83915991) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-cyclopropyl-5-isocyanatoimidazo[1,5-a]pyridine.
| Compound Name | 3-cyclopropyl-5-isocyanatoimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 83915991 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-cyclopropyl-5-isocyanatoimidazo[1,5-a]pyridine |
| SMILES | O=C=Nc1cccc2cnc(C3CC3)n12 |
| InChI | InChI=1S/C11H9N3O/c15-7-13-10-3-1-2-9-6-12-11(14(9)10)8-4-5-8/h1-3,6,8H,4-5H2 |
| InChIKey | LDADKXGGNXJLOX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|