C13H20N2O — CID 83917617
3-(5-methylfuran-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine (PubChem CID 83917617) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine.
| Compound Name | 3-(5-methylfuran-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 83917617 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazine |
| SMILES | Cc1ccc(C2CN3CCCCC3CN2)o1 |
| InChI | InChI=1S/C13H20N2O/c1-10-5-6-13(16-10)12-9-15-7-3-2-4-11(15)8-14-12/h5-6,11-12,14H,2-4,7-9H2,1H3 |
| InChIKey | BYFSMTUYZVHZBS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |