C14H20N2O2 — CID 79930963
5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)furan-2-carbaldehyde (PubChem CID 79930963) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)furan-2-carbaldehyde.
| Compound Name | 5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 79930963 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 5-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)furan-2-carbaldehyde |
| SMILES | CC1CN2CCCCC2CN1c1ccc(C=O)o1 |
| InChI | InChI=1S/C14H20N2O2/c1-11-8-15-7-3-2-4-12(15)9-16(11)14-6-5-13(10-17)18-14/h5-6,10-12H,2-4,7-9H2,1H3 |
| InChIKey | XXZYZMXGCQTTRS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|