C14H19NO2 — CID 62121405
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)furan-2-carbaldehyde (PubChem CID 62121405) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)furan-2-carbaldehyde.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 62121405 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(N2CCCC3CCCCC32)o1 |
| InChI | InChI=1S/C14H19NO2/c16-10-12-7-8-14(17-12)15-9-3-5-11-4-1-2-6-13(11)15/h7-8,10-11,13H,1-6,9H2 |
| InChIKey | BNBLUCUOCSZHAC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|