C16H26FNO2 — CID 83923062
4-(4,5-diethoxy-2-fluorophenyl)hexan-1-amine (PubChem CID 83923062) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-(4,5-diethoxy-2-fluorophenyl)hexan-1-amine.
| Compound Name | 4-(4,5-diethoxy-2-fluorophenyl)hexan-1-amine |
|---|---|
| PubChem CID | 83923062 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-(4,5-diethoxy-2-fluorophenyl)hexan-1-amine |
| SMILES | CCOc1cc(F)c(C(CC)CCCN)cc1OCC |
| InChI | InChI=1S/C16H26FNO2/c1-4-12(8-7-9-18)13-10-15(19-5-2)16(20-6-3)11-14(13)17/h10-12H,4-9,18H2,1-3H3 |
| InChIKey | NFHIRMOFHZRUDM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |