C12H17BrO2 — CID 83924520
4-(2-bromo-4-methylphenyl)pentane-1,2-diol (PubChem CID 83924520) has the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)pentane-1,2-diol.
| Compound Name | 4-(2-bromo-4-methylphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 83924520 |
| Molecular Formula | C12H17BrO2 |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)pentane-1,2-diol |
| SMILES | Cc1ccc(C(C)CC(O)CO)c(Br)c1 |
| InChI | InChI=1S/C12H17BrO2/c1-8-3-4-11(12(13)5-8)9(2)6-10(15)7-14/h3-5,9-10,14-15H,6-7H2,1-2H3 |
| InChIKey | FHOVTKWDJKCUCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |