C14H16F2 — CID 83925516
1,2-difluoro-3-(3-methylhept-4-yn-2-yl)benzene (PubChem CID 83925516) has the molecular formula C14H16F2 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1,2-difluoro-3-(3-methylhept-4-yn-2-yl)benzene.
| Compound Name | 1,2-difluoro-3-(3-methylhept-4-yn-2-yl)benzene |
|---|---|
| PubChem CID | 83925516 |
| Molecular Formula | C14H16F2 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1,2-difluoro-3-(3-methylhept-4-yn-2-yl)benzene |
| SMILES | CCC#CC(C)C(C)c1cccc(F)c1F |
| InChI | InChI=1S/C14H16F2/c1-4-5-7-10(2)11(3)12-8-6-9-13(15)14(12)16/h6,8-11H,4H2,1-3H3 |
| InChIKey | FZQOIBIMFNXYGK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|