C12H18FNO — CID 83925713
2-(aminomethyl)-4-(2-fluoro-4-methylphenyl)butan-1-ol (PubChem CID 83925713) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is 2-(aminomethyl)-4-(2-fluoro-4-methylphenyl)butan-1-ol.
| Compound Name | 2-(aminomethyl)-4-(2-fluoro-4-methylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83925713 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(aminomethyl)-4-(2-fluoro-4-methylphenyl)butan-1-ol |
| SMILES | Cc1ccc(CCC(CN)CO)c(F)c1 |
| InChI | InChI=1S/C12H18FNO/c1-9-2-4-11(12(13)6-9)5-3-10(7-14)8-15/h2,4,6,10,15H,3,5,7-8,14H2,1H3 |
| InChIKey | LOMPZYUHIGTUDR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |