About 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene
2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene (PubChem CID 142979204) has the molecular formula C19H31F
and a molecular weight of 278.45 g/mol. Its IUPAC name is 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene.
Molecular Properties
| Compound Name | 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene |
| PubChem CID | 142979204 |
| Molecular Formula | C19H31F |
| Molecular Weight | 278.45 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.CCC(C)CCc1ccc(C)cc1F |
| InChI | InChI=1S/C13H19F.C6H12/c1-4-10(2)5-7-12-8-6-11(3)9-13(12)14;1-4-6(3)5-2/h6,8-10H,4-5,7H2,1-3H3;4H,5H2,1-3H3/b;6-4+ |
| InChIKey | PAEVNCMZWRMBLU-DVXCEAISSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene?
The IUPAC name of 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene (CID 142979204) is 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene.
What is the SMILES notation for 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene?
The canonical SMILES for 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene is C/C=C(\C)CC.CCC(C)CCc1ccc(C)cc1F.
What is the InChIKey of 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene?
The InChIKey is PAEVNCMZWRMBLU-DVXCEAISSA-N. The full InChI is InChI=1S/C13H19F.C6H12/c1-4-10(2)5-7-12-8-6-11(3)9-13(12)14;1-4-6(3)5-2/h6,8-10H,4-5,7H2,1-3H3;4H,5H2,1-3H3/b;6-4+.
What are the key properties of 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene?
2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene has a molecular weight of 278.45 g/mol, XLogP of 6.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methyl-1-(3-methylpentyl)benzene;(E)-3-methylpent-2-ene is sourced from PubChem (CID 142979204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).