C19H30O — CID 83927621
2-[2-(5-tert-butyl-2-ethylphenyl)propyl]-3-ethyloxirane (PubChem CID 83927621) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[2-(5-tert-butyl-2-ethylphenyl)propyl]-3-ethyloxirane.
| Compound Name | 2-[2-(5-tert-butyl-2-ethylphenyl)propyl]-3-ethyloxirane |
|---|---|
| PubChem CID | 83927621 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 2-[2-(5-tert-butyl-2-ethylphenyl)propyl]-3-ethyloxirane |
| SMILES | CCc1ccc(C(C)(C)C)cc1C(C)CC1OC1CC |
| InChI | InChI=1S/C19H30O/c1-7-14-9-10-15(19(4,5)6)12-16(14)13(3)11-18-17(8-2)20-18/h9-10,12-13,17-18H,7-8,11H2,1-6H3 |
| InChIKey | VYJFNRBUXMTHEQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|