C19H32O2 — CID 83927642
6-(5-tert-butyl-2-ethylphenyl)heptane-3,4-diol (PubChem CID 83927642) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 6-(5-tert-butyl-2-ethylphenyl)heptane-3,4-diol.
| Compound Name | 6-(5-tert-butyl-2-ethylphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83927642 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 6-(5-tert-butyl-2-ethylphenyl)heptane-3,4-diol |
| SMILES | CCc1ccc(C(C)(C)C)cc1C(C)CC(O)C(O)CC |
| InChI | InChI=1S/C19H32O2/c1-7-14-9-10-15(19(4,5)6)12-16(14)13(3)11-18(21)17(20)8-2/h9-10,12-13,17-18,20-21H,7-8,11H2,1-6H3 |
| InChIKey | SOYSAFABZWUREU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |