C15H18BrFO2 — CID 83933943
methyl 2-[2-(5-bromo-2-fluorophenyl)butyl]cyclopropane-1-carboxylate (PubChem CID 83933943) has the molecular formula C15H18BrFO2 and a molecular weight of 329.21 g/mol. Its IUPAC name is methyl 2-[2-(5-bromo-2-fluorophenyl)butyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-(5-bromo-2-fluorophenyl)butyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83933943 |
| Molecular Formula | C15H18BrFO2 |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | methyl 2-[2-(5-bromo-2-fluorophenyl)butyl]cyclopropane-1-carboxylate |
| SMILES | CCC(CC1CC1C(=O)OC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H18BrFO2/c1-3-9(6-10-7-13(10)15(18)19-2)12-8-11(16)4-5-14(12)17/h4-5,8-10,13H,3,6-7H2,1-2H3 |
| InChIKey | BDPDEEGBXQNDCK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |