C16H23BrO2 — CID 83934178
1-bromo-2,4-diethoxy-5-[(Z)-2-methylpent-3-enyl]benzene (PubChem CID 83934178) has the molecular formula C16H23BrO2 and a molecular weight of 327.26 g/mol. Its IUPAC name is 1-bromo-2,4-diethoxy-5-[(Z)-2-methylpent-3-enyl]benzene.
| Compound Name | 1-bromo-2,4-diethoxy-5-[(Z)-2-methylpent-3-enyl]benzene |
|---|---|
| PubChem CID | 83934178 |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-bromo-2,4-diethoxy-5-[(Z)-2-methylpent-3-enyl]benzene |
| SMILES | C/C=C\C(C)Cc1cc(Br)c(OCC)cc1OCC |
| InChI | InChI=1S/C16H23BrO2/c1-5-8-12(4)9-13-10-14(17)16(19-7-3)11-15(13)18-6-2/h5,8,10-12H,6-7,9H2,1-4H3/b8-5- |
| InChIKey | WBYGGEYMPKCYNJ-YVMONPNESA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|