C19H33NO3 — CID 83934242
5-(2,3,4-triethoxyphenyl)heptan-2-amine (PubChem CID 83934242) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 5-(2,3,4-triethoxyphenyl)heptan-2-amine.
| Compound Name | 5-(2,3,4-triethoxyphenyl)heptan-2-amine |
|---|---|
| PubChem CID | 83934242 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 5-(2,3,4-triethoxyphenyl)heptan-2-amine |
| SMILES | CCOc1ccc(C(CC)CCC(C)N)c(OCC)c1OCC |
| InChI | InChI=1S/C19H33NO3/c1-6-15(11-10-14(5)20)16-12-13-17(21-7-2)19(23-9-4)18(16)22-8-3/h12-15H,6-11,20H2,1-5H3 |
| InChIKey | AKVIXTYVXVFGSM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |