C19H30O2 — CID 83934727
2-ethyl-3-[2-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]ethyl]oxirane (PubChem CID 83934727) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-ethyl-3-[2-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]ethyl]oxirane.
| Compound Name | 2-ethyl-3-[2-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]ethyl]oxirane |
|---|---|
| PubChem CID | 83934727 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-ethyl-3-[2-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]ethyl]oxirane |
| SMILES | CCC1OC1CCc1ccc(OCC(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C19H30O2/c1-6-17-19(21-17)10-8-15-7-9-18(20-12-13(2)3)16(11-15)14(4)5/h7,9,11,13-14,17,19H,6,8,10,12H2,1-5H3 |
| InChIKey | KXGHPEUGTWMXTN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|