About 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine
2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine (PubChem CID 83934966) has the molecular formula C10H17BrN2S
and a molecular weight of 277.23 g/mol. Its IUPAC name is 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine |
| PubChem CID | 83934966 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine |
| SMILES | CC(Cc1ccc(Br)s1)C(CN)CN |
| InChI | InChI=1S/C10H17BrN2S/c1-7(8(5-12)6-13)4-9-2-3-10(11)14-9/h2-3,7-8H,4-6,12-13H2,1H3 |
| InChIKey | KQEFWOQZDMHEPV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine?
The IUPAC name of 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine (CID 83934966) is 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine.
What is the SMILES notation for 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine?
The canonical SMILES for 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine is CC(Cc1ccc(Br)s1)C(CN)CN.
What is the InChIKey of 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine?
The InChIKey is KQEFWOQZDMHEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrN2S/c1-7(8(5-12)6-13)4-9-2-3-10(11)14-9/h2-3,7-8H,4-6,12-13H2,1H3.
What are the key properties of 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine?
2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine has a molecular weight of 277.23 g/mol, XLogP of 2.22, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5-bromothiophen-2-yl)propan-2-yl]propane-1,3-diamine is sourced from PubChem (CID 83934966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).