C14H24N2O2 — CID 83936851
2,4-diamino-1-(2-methyl-4-propoxyphenyl)butan-1-ol (PubChem CID 83936851) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2,4-diamino-1-(2-methyl-4-propoxyphenyl)butan-1-ol.
| Compound Name | 2,4-diamino-1-(2-methyl-4-propoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 83936851 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2,4-diamino-1-(2-methyl-4-propoxyphenyl)butan-1-ol |
| SMILES | CCCOc1ccc(C(O)C(N)CCN)c(C)c1 |
| InChI | InChI=1S/C14H24N2O2/c1-3-8-18-11-4-5-12(10(2)9-11)14(17)13(16)6-7-15/h4-5,9,13-14,17H,3,6-8,15-16H2,1-2H3 |
| InChIKey | AFRKQWMMYIEMPQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |