C12H16ClNOS — CID 83938122
3-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanethioamide (PubChem CID 83938122) has the molecular formula C12H16ClNOS and a molecular weight of 257.79 g/mol. Its IUPAC name is 3-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanethioamide.
| Compound Name | 3-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanethioamide |
|---|---|
| PubChem CID | 83938122 |
| Molecular Formula | C12H16ClNOS |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-(3-chloro-6-methoxy-2,4-dimethylphenyl)propanethioamide |
| SMILES | COc1cc(C)c(Cl)c(C)c1CCC(N)=S |
| InChI | InChI=1S/C12H16ClNOS/c1-7-6-10(15-3)9(4-5-11(14)16)8(2)12(7)13/h6H,4-5H2,1-3H3,(H2,14,16) |
| InChIKey | NEGUJCBDZBLZTJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|