C19H33NO2 — CID 83938573
3-(3,5-ditert-butyl-4-methoxyphenyl)-3-(methylamino)propan-1-ol (PubChem CID 83938573) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-methoxyphenyl)-3-(methylamino)propan-1-ol.
| Compound Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 83938573 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)-3-(methylamino)propan-1-ol |
| SMILES | CNC(CCO)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO2/c1-18(2,3)14-11-13(16(20-7)9-10-21)12-15(17(14)22-8)19(4,5)6/h11-12,16,20-21H,9-10H2,1-8H3 |
| InChIKey | SQIBSHWDQIXSHV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |