C15H19NO3 — CID 83944844
2-[3-(3-hydroxypropyl)-4,6-dimethylindol-1-yl]acetic acid (PubChem CID 83944844) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[3-(3-hydroxypropyl)-4,6-dimethylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(3-hydroxypropyl)-4,6-dimethylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83944844 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[3-(3-hydroxypropyl)-4,6-dimethylindol-1-yl]acetic acid |
| SMILES | Cc1cc(C)c2c(CCCO)cn(CC(=O)O)c2c1 |
| InChI | InChI=1S/C15H19NO3/c1-10-6-11(2)15-12(4-3-5-17)8-16(9-14(18)19)13(15)7-10/h6-8,17H,3-5,9H2,1-2H3,(H,18,19) |
| InChIKey | PICXOCLFPIKTSX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |