C18H30N2O2 — CID 83956961
N-[(5,8-dimethoxy-1-propyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]propan-1-amine (PubChem CID 83956961) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[(5,8-dimethoxy-1-propyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]propan-1-amine.
| Compound Name | N-[(5,8-dimethoxy-1-propyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 83956961 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-[(5,8-dimethoxy-1-propyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(OC)c2c(c1OC)CCNC2CCC |
| InChI | InChI=1S/C18H30N2O2/c1-5-7-15-17-14(8-10-20-15)18(22-4)13(11-16(17)21-3)12-19-9-6-2/h11,15,19-20H,5-10,12H2,1-4H3 |
| InChIKey | GCWONBIGZDZIHH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|