C15H21F3N2O2 — CID 83956932
N-[(5,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 83956932) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is N-[(5,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[(5,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 83956932 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[(5,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | COc1cc(CNCC(F)(F)F)c(OC)c2c1C(C)NCC2 |
| InChI | InChI=1S/C15H21F3N2O2/c1-9-13-11(4-5-20-9)14(22-3)10(6-12(13)21-2)7-19-8-15(16,17)18/h6,9,19-20H,4-5,7-8H2,1-3H3 |
| InChIKey | DYIOTZVIGUNRAC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |