C16H21ClO4 — CID 83959337
(E)-4-(5-chloro-2,4-diethoxyphenyl)hex-3-enoic acid (PubChem CID 83959337) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is (E)-4-(5-chloro-2,4-diethoxyphenyl)hex-3-enoic acid.
| Compound Name | (E)-4-(5-chloro-2,4-diethoxyphenyl)hex-3-enoic acid |
|---|---|
| PubChem CID | 83959337 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (E)-4-(5-chloro-2,4-diethoxyphenyl)hex-3-enoic acid |
| SMILES | CCOc1cc(OCC)c(/C(=C/CC(=O)O)CC)cc1Cl |
| InChI | InChI=1S/C16H21ClO4/c1-4-11(7-8-16(18)19)12-9-13(17)15(21-6-3)10-14(12)20-5-2/h7,9-10H,4-6,8H2,1-3H3,(H,18,19)/b11-7+ |
| InChIKey | KABSRPXIRGJVDS-YRNVUSSQSA-N |
| XLogP | 4.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |