C15H20N2O3 — CID 83963959
1-(2-aminoethyl)-3-(1-hydroxyethyl)-2,5-dimethylindole-6-carboxylic acid (PubChem CID 83963959) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(1-hydroxyethyl)-2,5-dimethylindole-6-carboxylic acid.
| Compound Name | 1-(2-aminoethyl)-3-(1-hydroxyethyl)-2,5-dimethylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 83963959 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-(2-aminoethyl)-3-(1-hydroxyethyl)-2,5-dimethylindole-6-carboxylic acid |
| SMILES | Cc1cc2c(C(C)O)c(C)n(CCN)c2cc1C(=O)O |
| InChI | InChI=1S/C15H20N2O3/c1-8-6-12-13(7-11(8)15(19)20)17(5-4-16)9(2)14(12)10(3)18/h6-7,10,18H,4-5,16H2,1-3H3,(H,19,20) |
| InChIKey | WTXIBUPPVSCPAB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|