C8H13FN4O — CID 83965586
6-fluoro-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 83965586) has the molecular formula C8H13FN4O and a molecular weight of 200.22 g/mol. Its IUPAC name is 6-fluoro-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 6-fluoro-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83965586 |
| Molecular Formula | C8H13FN4O |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-fluoro-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCc1nc2n(n1)CC(F)CC2N |
| InChI | InChI=1S/C8H13FN4O/c1-14-4-7-11-8-6(10)2-5(9)3-13(8)12-7/h5-6H,2-4,10H2,1H3 |
| InChIKey | KMUWTIHVDJJVFT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |