C14H17FN4O2 — CID 83966034
3-(3,4-dimethoxyphenyl)-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine (PubChem CID 83966034) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83966034 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6-fluoro-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| SMILES | COc1ccc(-c2nnc3n2CC(F)CC3N)cc1OC |
| InChI | InChI=1S/C14H17FN4O2/c1-20-11-4-3-8(5-12(11)21-2)13-17-18-14-10(16)6-9(15)7-19(13)14/h3-5,9-10H,6-7,16H2,1-2H3 |
| InChIKey | DVZVASXLUWXUPT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |