C17H21N3 — CID 83969556
2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-amine (PubChem CID 83969556) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 83969556 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-amine |
| SMILES | Nc1c(-c2ccc3c(c2)CCCC3)nc2n1CCCC2 |
| InChI | InChI=1S/C17H21N3/c18-17-16(19-15-7-3-4-10-20(15)17)14-9-8-12-5-1-2-6-13(12)11-14/h8-9,11H,1-7,10,18H2 |
| InChIKey | GPWILDOCPBNSLF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |