C18H23N3 — CID 83966172
3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine (PubChem CID 83966172) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine.
| Compound Name | 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83966172 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 3-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1c(-c2ccc3c(c2)CCCC3)nc2n1CCCC2N |
| InChI | InChI=1S/C18H23N3/c1-12-17(20-18-16(19)7-4-10-21(12)18)15-9-8-13-5-2-3-6-14(13)11-15/h8-9,11,16H,2-7,10,19H2,1H3 |
| InChIKey | NDVXDGDZICAXDZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |