C19H25NO4 — CID 83972538
2-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 83972538) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83972538 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-(4-methoxyphenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(C(CN)Cc2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-21-16-7-5-13(6-8-16)15(12-20)9-14-10-18(23-3)19(24-4)11-17(14)22-2/h5-8,10-11,15H,9,12,20H2,1-4H3 |
| InChIKey | PDZGMXWOPPROIT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |