C17H19F2NO2 — CID 83973696
2-(3,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)propan-1-amine (PubChem CID 83973696) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(3,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83973696 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-(2,5-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1ccc(OC)c(CC(CN)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H19F2NO2/c1-21-14-4-6-17(22-2)12(8-14)7-13(10-20)11-3-5-15(18)16(19)9-11/h3-6,8-9,13H,7,10,20H2,1-2H3 |
| InChIKey | XPQXFGFNOZCUSX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |