C18H22FNO3 — CID 83973785
2-(4-fluorophenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 83973785) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | 2-(4-fluorophenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 83973785 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(2,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc(OC)c(OC)cc1CC(CN)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FNO3/c1-21-16-10-18(23-3)17(22-2)9-13(16)8-14(11-20)12-4-6-15(19)7-5-12/h4-7,9-10,14H,8,11,20H2,1-3H3 |
| InChIKey | XOHBTWDLHMEANA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |