C15H16ClNO — CID 83975370
4-[1-amino-3-(3-chlorophenyl)propan-2-yl]phenol (PubChem CID 83975370) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 4-[1-amino-3-(3-chlorophenyl)propan-2-yl]phenol.
| Compound Name | 4-[1-amino-3-(3-chlorophenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 83975370 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-[1-amino-3-(3-chlorophenyl)propan-2-yl]phenol |
| SMILES | NCC(Cc1cccc(Cl)c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16ClNO/c16-14-3-1-2-11(9-14)8-13(10-17)12-4-6-15(18)7-5-12/h1-7,9,13,18H,8,10,17H2 |
| InChIKey | YXUAEGOEVGBPHR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |