C16H23Cl2NO2 — CID 83975743
2-(2,3-dichlorophenyl)-2-(4,4-dimethoxycyclohexyl)ethanamine (PubChem CID 83975743) has the molecular formula C16H23Cl2NO2 and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-2-(4,4-dimethoxycyclohexyl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-2-(4,4-dimethoxycyclohexyl)ethanamine |
|---|---|
| PubChem CID | 83975743 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-2-(4,4-dimethoxycyclohexyl)ethanamine |
| SMILES | COC1(OC)CCC(C(CN)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C16H23Cl2NO2/c1-20-16(21-2)8-6-11(7-9-16)13(10-19)12-4-3-5-14(17)15(12)18/h3-5,11,13H,6-10,19H2,1-2H3 |
| InChIKey | UUNPLHJQVMJRHC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|