C14H23NO2S — CID 83975901
2-(4,4-dimethoxycyclohexyl)-2-thiophen-2-ylethanamine (PubChem CID 83975901) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(4,4-dimethoxycyclohexyl)-2-thiophen-2-ylethanamine.
| Compound Name | 2-(4,4-dimethoxycyclohexyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 83975901 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(4,4-dimethoxycyclohexyl)-2-thiophen-2-ylethanamine |
| SMILES | COC1(OC)CCC(C(CN)c2cccs2)CC1 |
| InChI | InChI=1S/C14H23NO2S/c1-16-14(17-2)7-5-11(6-8-14)12(10-15)13-4-3-9-18-13/h3-4,9,11-12H,5-8,10,15H2,1-2H3 |
| InChIKey | ADPNQIMWJYVIRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|