C17H24N2O2S — CID 83976239
2-(1,3-benzothiazol-2-yl)-2-(4,4-dimethoxycyclohexyl)ethanamine (PubChem CID 83976239) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-2-(4,4-dimethoxycyclohexyl)ethanamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-2-(4,4-dimethoxycyclohexyl)ethanamine |
|---|---|
| PubChem CID | 83976239 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-2-(4,4-dimethoxycyclohexyl)ethanamine |
| SMILES | COC1(OC)CCC(C(CN)c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H24N2O2S/c1-20-17(21-2)9-7-12(8-10-17)13(11-18)16-19-14-5-3-4-6-15(14)22-16/h3-6,12-13H,7-11,18H2,1-2H3 |
| InChIKey | RELUKKWCQUKKBO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|