C17H31N3O — CID 83978838
N-[2-(furan-2-yl)-2-(3-methylpiperazin-1-yl)ethyl]-N-propylpropan-1-amine (PubChem CID 83978838) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-(3-methylpiperazin-1-yl)ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-(furan-2-yl)-2-(3-methylpiperazin-1-yl)ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 83978838 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-[2-(furan-2-yl)-2-(3-methylpiperazin-1-yl)ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CC(c1ccco1)N1CCNC(C)C1 |
| InChI | InChI=1S/C17H31N3O/c1-4-9-19(10-5-2)14-16(17-7-6-12-21-17)20-11-8-18-15(3)13-20/h6-7,12,15-16,18H,4-5,8-11,13-14H2,1-3H3 |
| InChIKey | PPDDCZISRLUFBB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |