C17H28N2O3 — CID 83979558
2-(4-methoxy-3-propan-2-yloxyphenyl)-2-(2-methylpiperazin-1-yl)ethanol (PubChem CID 83979558) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-(4-methoxy-3-propan-2-yloxyphenyl)-2-(2-methylpiperazin-1-yl)ethanol.
| Compound Name | 2-(4-methoxy-3-propan-2-yloxyphenyl)-2-(2-methylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 83979558 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-(4-methoxy-3-propan-2-yloxyphenyl)-2-(2-methylpiperazin-1-yl)ethanol |
| SMILES | COc1ccc(C(CO)N2CCNCC2C)cc1OC(C)C |
| InChI | InChI=1S/C17H28N2O3/c1-12(2)22-17-9-14(5-6-16(17)21-4)15(11-20)19-8-7-18-10-13(19)3/h5-6,9,12-13,15,18,20H,7-8,10-11H2,1-4H3 |
| InChIKey | IYPHYKLGPNDSSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |