C14H17Cl2N3O — CID 83979913
2-(3,5-dichloro-4-ethoxyphenyl)-2-piperazin-1-ylacetonitrile (PubChem CID 83979913) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-ethoxyphenyl)-2-piperazin-1-ylacetonitrile.
| Compound Name | 2-(3,5-dichloro-4-ethoxyphenyl)-2-piperazin-1-ylacetonitrile |
|---|---|
| PubChem CID | 83979913 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(3,5-dichloro-4-ethoxyphenyl)-2-piperazin-1-ylacetonitrile |
| SMILES | CCOc1c(Cl)cc(C(C#N)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O/c1-2-20-14-11(15)7-10(8-12(14)16)13(9-17)19-5-3-18-4-6-19/h7-8,13,18H,2-6H2,1H3 |
| InChIKey | SDWLKIJDMCZTAH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |