C17H23F3N2O2 — CID 83980212
2-(2-methyl-4-propylpiperazin-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 83980212) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-(2-methyl-4-propylpiperazin-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-(2-methyl-4-propylpiperazin-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 83980212 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-(2-methyl-4-propylpiperazin-1-yl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | CCCN1CCN(C(C(=O)O)c2cccc(C(F)(F)F)c2)C(C)C1 |
| InChI | InChI=1S/C17H23F3N2O2/c1-3-7-21-8-9-22(12(2)11-21)15(16(23)24)13-5-4-6-14(10-13)17(18,19)20/h4-6,10,12,15H,3,7-9,11H2,1-2H3,(H,23,24) |
| InChIKey | QJLWOLCCZJPYSS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |