C21H34N2 — CID 83993954
N-benzyl-1-(1-cyclobutylethyl)-5-propan-2-ylpiperidin-3-amine (PubChem CID 83993954) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N-benzyl-1-(1-cyclobutylethyl)-5-propan-2-ylpiperidin-3-amine.
| Compound Name | N-benzyl-1-(1-cyclobutylethyl)-5-propan-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83993954 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N-benzyl-1-(1-cyclobutylethyl)-5-propan-2-ylpiperidin-3-amine |
| SMILES | CC(C)C1CC(NCc2ccccc2)CN(C(C)C2CCC2)C1 |
| InChI | InChI=1S/C21H34N2/c1-16(2)20-12-21(22-13-18-8-5-4-6-9-18)15-23(14-20)17(3)19-10-7-11-19/h4-6,8-9,16-17,19-22H,7,10-15H2,1-3H3 |
| InChIKey | MSFRJRDSZSRYAJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |